C22H18BrN3O3 — CID 11879923
(3S,4S)-N-[[5-(3-bromophenyl)furan-2-yl]methylideneamino]-2-oxo-4-phenylpyrrolidine-3-carboxamide (PubChem CID 11879923) has the molecular formula C22H18BrN3O3 and a molecular weight of 452.31 g/mol. Its IUPAC name is (3S,4S)-N-[[5-(3-bromophenyl)furan-2-yl]methylideneamino]-2-oxo-4-phenylpyrrolidine-3-carboxamide.
| Compound Name | (3S,4S)-N-[[5-(3-bromophenyl)furan-2-yl]methylideneamino]-2-oxo-4-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 11879923 |
| Molecular Formula | C22H18BrN3O3 |
| Molecular Weight | 452.31 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | (3S,4S)-N-[[5-(3-bromophenyl)furan-2-yl]methylideneamino]-2-oxo-4-phenylpyrrolidine-3-carboxamide |
| SMILES | O=C1NC[C@H](c2ccccc2)[C@@H]1C(=O)NN=Cc1ccc(-c2cccc(Br)c2)o1 |
| InChI | InChI=1S/C22H18BrN3O3/c23-16-8-4-7-15(11-16)19-10-9-17(29-19)12-25-26-22(28)20-18(13-24-21(20)27)14-5-2-1-3-6-14/h1-12,18,20H,13H2,(H,24,27)(H,26,28)/t18-,20+/m1/s1 |
| InChIKey | XOBHFJZUDLGKJV-QUCCMNQESA-N |
| XLogP | 3.69 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.31 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|