C17H15BrN2O — CID 6975061
cis-(1R,2S)-N-[(Z)-(4-bromophenyl)methylideneamino]-2-phenylcyclopropane-1-carboxamide (PubChem CID 6975061) has the molecular formula C17H15BrN2O and a molecular weight of 343.22 g/mol. Its IUPAC name is cis-(1R,2S)-N-[(Z)-(4-bromophenyl)methylideneamino]-2-phenylcyclopropane-1-carboxamide.
| Compound Name | cis-(1R,2S)-N-[(Z)-(4-bromophenyl)methylideneamino]-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 6975061 |
| Molecular Formula | C17H15BrN2O |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | cis-(1R,2S)-N-[(Z)-(4-bromophenyl)methylideneamino]-2-phenylcyclopropane-1-carboxamide |
| SMILES | O=C(N/N=C\c1ccc(Br)cc1)[C@@H]1C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C17H15BrN2O/c18-14-8-6-12(7-9-14)11-19-20-17(21)16-10-15(16)13-4-2-1-3-5-13/h1-9,11,15-16H,10H2,(H,20,21)/b19-11-/t15-,16-/m1/s1 |
| InChIKey | QJJWMBOQPFQCPQ-DEKPZMAWSA-N |
| XLogP | 3.70 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|