C19H21N3O — CID 129439856
cis-(1S,2R)-N-[[4-(dimethylamino)phenyl]methylideneamino]-2-phenylcyclopropane-1-carboxamide (PubChem CID 129439856) has the molecular formula C19H21N3O and a molecular weight of 307.40 g/mol. Its IUPAC name is cis-(1S,2R)-N-[[4-(dimethylamino)phenyl]methylideneamino]-2-phenylcyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2R)-N-[[4-(dimethylamino)phenyl]methylideneamino]-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 129439856 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | cis-(1S,2R)-N-[[4-(dimethylamino)phenyl]methylideneamino]-2-phenylcyclopropane-1-carboxamide |
| SMILES | CN(C)c1ccc(C=NNC(=O)[C@H]2C[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C19H21N3O/c1-22(2)16-10-8-14(9-11-16)13-20-21-19(23)18-12-17(18)15-6-4-3-5-7-15/h3-11,13,17-18H,12H2,1-2H3,(H,21,23)/t17-,18-/m0/s1 |
| InChIKey | OYZZCWPTOMESCN-ROUUACIJSA-N |
| XLogP | 3.01 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|