C17H14Br2N2O — CID 6736120
N-[(3,4-dibromophenyl)methylideneamino]-2-phenylcyclopropane-1-carboxamide (PubChem CID 6736120) has the molecular formula C17H14Br2N2O and a molecular weight of 422.12 g/mol. Its IUPAC name is N-[(3,4-dibromophenyl)methylideneamino]-2-phenylcyclopropane-1-carboxamide.
| Compound Name | N-[(3,4-dibromophenyl)methylideneamino]-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 6736120 |
| Molecular Formula | C17H14Br2N2O |
| Molecular Weight | 422.12 g/mol |
| Exact Mass | 419.95 |
| IUPAC Name | N-[(3,4-dibromophenyl)methylideneamino]-2-phenylcyclopropane-1-carboxamide |
| SMILES | O=C(NN=Cc1ccc(Br)c(Br)c1)C1CC1c1ccccc1 |
| InChI | InChI=1S/C17H14Br2N2O/c18-15-7-6-11(8-16(15)19)10-20-21-17(22)14-9-13(14)12-4-2-1-3-5-12/h1-8,10,13-14H,9H2,(H,21,22) |
| InChIKey | CKTUOTHEQIJTKI-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.12 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|