C18H12Br2N2O2 — CID 41300906
2-bromo-N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]benzamide (PubChem CID 41300906) has the molecular formula C18H12Br2N2O2 and a molecular weight of 448.11 g/mol. Its IUPAC name is 2-bromo-N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]benzamide.
| Compound Name | 2-bromo-N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 41300906 |
| Molecular Formula | C18H12Br2N2O2 |
| Molecular Weight | 448.11 g/mol |
| Exact Mass | 445.93 |
| IUPAC Name | 2-bromo-N-[(Z)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]benzamide |
| SMILES | O=C(N/N=C\c1ccc(-c2ccc(Br)cc2)o1)c1ccccc1Br |
| InChI | InChI=1S/C18H12Br2N2O2/c19-13-7-5-12(6-8-13)17-10-9-14(24-17)11-21-22-18(23)15-3-1-2-4-16(15)20/h1-11H,(H,22,23)/b21-11- |
| InChIKey | SJLOYCHIABVTPW-NHDPSOOVSA-N |
| XLogP | 5.24 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.11 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|