C18H10BrCl3N2O2 — CID 41339727
2-bromo-N-[(Z)-[5-(2,4,5-trichlorophenyl)furan-2-yl]methylideneamino]benzamide (PubChem CID 41339727) has the molecular formula C18H10BrCl3N2O2 and a molecular weight of 472.55 g/mol. Its IUPAC name is 2-bromo-N-[(Z)-[5-(2,4,5-trichlorophenyl)furan-2-yl]methylideneamino]benzamide.
| Compound Name | 2-bromo-N-[(Z)-[5-(2,4,5-trichlorophenyl)furan-2-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 41339727 |
| Molecular Formula | C18H10BrCl3N2O2 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 469.90 |
| IUPAC Name | 2-bromo-N-[(Z)-[5-(2,4,5-trichlorophenyl)furan-2-yl]methylideneamino]benzamide |
| SMILES | O=C(N/N=C\c1ccc(-c2cc(Cl)c(Cl)cc2Cl)o1)c1ccccc1Br |
| InChI | InChI=1S/C18H10BrCl3N2O2/c19-13-4-2-1-3-11(13)18(25)24-23-9-10-5-6-17(26-10)12-7-15(21)16(22)8-14(12)20/h1-9H,(H,24,25)/b23-9- |
| InChIKey | OSDSTVOXRNAUMV-AQHIEDMUSA-N |
| XLogP | 6.43 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|