C22H19BrClN3O3 — CID 126177531
N-[(2R)-1-[(2Z)-2-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene]hydrazinyl]-1-oxopropan-2-yl]-2-chlorobenzamide (PubChem CID 126177531) has the molecular formula C22H19BrClN3O3 and a molecular weight of 488.77 g/mol. Its IUPAC name is N-[(2R)-1-[(2Z)-2-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene]hydrazinyl]-1-oxopropan-2-yl]-2-chlorobenzamide.
| Compound Name | N-[(2R)-1-[(2Z)-2-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene]hydrazinyl]-1-oxopropan-2-yl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 126177531 |
| Molecular Formula | C22H19BrClN3O3 |
| Molecular Weight | 488.77 g/mol |
| Exact Mass | 487.03 |
| IUPAC Name | N-[(2R)-1-[(2Z)-2-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene]hydrazinyl]-1-oxopropan-2-yl]-2-chlorobenzamide |
| SMILES | Cc1ccc(-c2ccc(/C=N\NC(=O)[C@@H](C)NC(=O)c3ccccc3Cl)o2)c(Br)c1 |
| InChI | InChI=1S/C22H19BrClN3O3/c1-13-7-9-16(18(23)11-13)20-10-8-15(30-20)12-25-27-21(28)14(2)26-22(29)17-5-3-4-6-19(17)24/h3-12,14H,1-2H3,(H,26,29)(H,27,28)/b25-12-/t14-/m1/s1 |
| InChIKey | ZQAXRKLAOLBBOB-QTYGBZKPSA-N |
| XLogP | 4.94 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.77 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|