C24H23ClN4O6 — CID 3506541
2-chloro-N-[1-[2-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 3506541) has the molecular formula C24H23ClN4O6 and a molecular weight of 498.92 g/mol. Its IUPAC name is 2-chloro-N-[1-[2-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 2-chloro-N-[1-[2-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 3506541 |
| Molecular Formula | C24H23ClN4O6 |
| Molecular Weight | 498.92 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | 2-chloro-N-[1-[2-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | COc1ccc(-c2ccc(C=NNC(=O)C(NC(=O)c3ccccc3Cl)C(C)C)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H23ClN4O6/c1-14(2)22(27-23(30)17-6-4-5-7-19(17)25)24(31)28-26-13-16-9-11-21(35-16)18-10-8-15(34-3)12-20(18)29(32)33/h4-14,22H,1-3H3,(H,27,30)(H,28,31) |
| InChIKey | DRSNNMOYFKRPSM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.92 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|