C24H22BrCl2N3O3 — CID 126163480
N-[(2R)-1-[(2Z)-2-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2,4-dichlorobenzamide (PubChem CID 126163480) has the molecular formula C24H22BrCl2N3O3 and a molecular weight of 551.27 g/mol. Its IUPAC name is N-[(2R)-1-[(2Z)-2-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2,4-dichlorobenzamide.
| Compound Name | N-[(2R)-1-[(2Z)-2-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 126163480 |
| Molecular Formula | C24H22BrCl2N3O3 |
| Molecular Weight | 551.27 g/mol |
| Exact Mass | 549.02 |
| IUPAC Name | N-[(2R)-1-[(2Z)-2-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2,4-dichlorobenzamide |
| SMILES | Cc1ccc(-c2ccc(/C=N\NC(=O)[C@H](NC(=O)c3ccc(Cl)cc3Cl)C(C)C)o2)c(Br)c1 |
| InChI | InChI=1S/C24H22BrCl2N3O3/c1-13(2)22(29-23(31)18-8-5-15(26)11-20(18)27)24(32)30-28-12-16-6-9-21(33-16)17-7-4-14(3)10-19(17)25/h4-13,22H,1-3H3,(H,29,31)(H,30,32)/b28-12-/t22-/m1/s1 |
| InChIKey | QIADIQXPSWITFZ-HRVUXXLOSA-N |
| XLogP | 6.23 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.27 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|