C23H19Cl3N4O5 — CID 3540108
4-chloro-N-[1-[2-[[5-(2,5-dichloro-4-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 3540108) has the molecular formula C23H19Cl3N4O5 and a molecular weight of 537.79 g/mol. Its IUPAC name is 4-chloro-N-[1-[2-[[5-(2,5-dichloro-4-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-chloro-N-[1-[2-[[5-(2,5-dichloro-4-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 3540108 |
| Molecular Formula | C23H19Cl3N4O5 |
| Molecular Weight | 537.79 g/mol |
| Exact Mass | 536.04 |
| IUPAC Name | 4-chloro-N-[1-[2-[[5-(2,5-dichloro-4-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | CC(C)C(NC(=O)c1ccc(Cl)cc1)C(=O)NN=Cc1ccc(-c2cc(Cl)c([N+](=O)[O-])cc2Cl)o1 |
| InChI | InChI=1S/C23H19Cl3N4O5/c1-12(2)21(28-22(31)13-3-5-14(24)6-4-13)23(32)29-27-11-15-7-8-20(35-15)16-9-18(26)19(30(33)34)10-17(16)25/h3-12,21H,1-2H3,(H,28,31)(H,29,32) |
| InChIKey | ZSMDPWYAUKZILU-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.79 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|