C17H17BrClN3O3 — CID 6377948
N-[1-[(2Z)-2-[(5-bromofuran-2-yl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-chlorobenzamide (PubChem CID 6377948) has the molecular formula C17H17BrClN3O3 and a molecular weight of 426.70 g/mol. Its IUPAC name is N-[1-[(2Z)-2-[(5-bromofuran-2-yl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-chlorobenzamide.
| Compound Name | N-[1-[(2Z)-2-[(5-bromofuran-2-yl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 6377948 |
| Molecular Formula | C17H17BrClN3O3 |
| Molecular Weight | 426.70 g/mol |
| Exact Mass | 425.01 |
| IUPAC Name | N-[1-[(2Z)-2-[(5-bromofuran-2-yl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-chlorobenzamide |
| SMILES | CC(C)C(NC(=O)c1ccc(Cl)cc1)C(=O)N/N=C\c1ccc(Br)o1 |
| InChI | InChI=1S/C17H17BrClN3O3/c1-10(2)15(21-16(23)11-3-5-12(19)6-4-11)17(24)22-20-9-13-7-8-14(18)25-13/h3-10,15H,1-2H3,(H,21,23)(H,22,24)/b20-9- |
| InChIKey | GZOLHJRERHRCLG-UKWGHVSLSA-N |
| XLogP | 3.60 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.70 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|