C23H27ClN4O2 — CID 3983531
4-chloro-N-[3-methyl-1-oxo-1-[2-[(4-pyrrolidin-1-ylphenyl)methylidene]hydrazinyl]butan-2-yl]benzamide (PubChem CID 3983531) has the molecular formula C23H27ClN4O2 and a molecular weight of 426.95 g/mol. Its IUPAC name is 4-chloro-N-[3-methyl-1-oxo-1-[2-[(4-pyrrolidin-1-ylphenyl)methylidene]hydrazinyl]butan-2-yl]benzamide.
| Compound Name | 4-chloro-N-[3-methyl-1-oxo-1-[2-[(4-pyrrolidin-1-ylphenyl)methylidene]hydrazinyl]butan-2-yl]benzamide |
|---|---|
| PubChem CID | 3983531 |
| Molecular Formula | C23H27ClN4O2 |
| Molecular Weight | 426.95 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 4-chloro-N-[3-methyl-1-oxo-1-[2-[(4-pyrrolidin-1-ylphenyl)methylidene]hydrazinyl]butan-2-yl]benzamide |
| SMILES | CC(C)C(NC(=O)c1ccc(Cl)cc1)C(=O)NN=Cc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C23H27ClN4O2/c1-16(2)21(26-22(29)18-7-9-19(24)10-8-18)23(30)27-25-15-17-5-11-20(12-6-17)28-13-3-4-14-28/h5-12,15-16,21H,3-4,13-14H2,1-2H3,(H,26,29)(H,27,30) |
| InChIKey | KZVICSYQRVKCOG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.95 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|