C23H26Cl2N4O2 — CID 6252608
3,4-dichloro-N-[3-methyl-1-oxo-1-[(2Z)-2-[(4-pyrrolidin-1-ylphenyl)methylidene]hydrazinyl]butan-2-yl]benzamide (PubChem CID 6252608) has the molecular formula C23H26Cl2N4O2 and a molecular weight of 461.39 g/mol. Its IUPAC name is 3,4-dichloro-N-[3-methyl-1-oxo-1-[(2Z)-2-[(4-pyrrolidin-1-ylphenyl)methylidene]hydrazinyl]butan-2-yl]benzamide.
| Compound Name | 3,4-dichloro-N-[3-methyl-1-oxo-1-[(2Z)-2-[(4-pyrrolidin-1-ylphenyl)methylidene]hydrazinyl]butan-2-yl]benzamide |
|---|---|
| PubChem CID | 6252608 |
| Molecular Formula | C23H26Cl2N4O2 |
| Molecular Weight | 461.39 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 3,4-dichloro-N-[3-methyl-1-oxo-1-[(2Z)-2-[(4-pyrrolidin-1-ylphenyl)methylidene]hydrazinyl]butan-2-yl]benzamide |
| SMILES | CC(C)C(NC(=O)c1ccc(Cl)c(Cl)c1)C(=O)N/N=C\c1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C23H26Cl2N4O2/c1-15(2)21(27-22(30)17-7-10-19(24)20(25)13-17)23(31)28-26-14-16-5-8-18(9-6-16)29-11-3-4-12-29/h5-10,13-15,21H,3-4,11-12H2,1-2H3,(H,27,30)(H,28,31)/b26-14- |
| InChIKey | ZZLYMVKXPSPWPY-WGARJPEWSA-N |
| XLogP | 4.50 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.39 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|