C22H25Cl2N3O3 — CID 3993564
3,4-dichloro-N-[3-methyl-1-oxo-1-[2-[(3-propoxyphenyl)methylidene]hydrazinyl]butan-2-yl]benzamide (PubChem CID 3993564) has the molecular formula C22H25Cl2N3O3 and a molecular weight of 450.37 g/mol. Its IUPAC name is 3,4-dichloro-N-[3-methyl-1-oxo-1-[2-[(3-propoxyphenyl)methylidene]hydrazinyl]butan-2-yl]benzamide.
| Compound Name | 3,4-dichloro-N-[3-methyl-1-oxo-1-[2-[(3-propoxyphenyl)methylidene]hydrazinyl]butan-2-yl]benzamide |
|---|---|
| PubChem CID | 3993564 |
| Molecular Formula | C22H25Cl2N3O3 |
| Molecular Weight | 450.37 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | 3,4-dichloro-N-[3-methyl-1-oxo-1-[2-[(3-propoxyphenyl)methylidene]hydrazinyl]butan-2-yl]benzamide |
| SMILES | CCCOc1cccc(C=NNC(=O)C(NC(=O)c2ccc(Cl)c(Cl)c2)C(C)C)c1 |
| InChI | InChI=1S/C22H25Cl2N3O3/c1-4-10-30-17-7-5-6-15(11-17)13-25-27-22(29)20(14(2)3)26-21(28)16-8-9-18(23)19(24)12-16/h5-9,11-14,20H,4,10H2,1-3H3,(H,26,28)(H,27,29) |
| InChIKey | ZYCKZWZGEYWEQA-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.37 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|