C27H29Cl2N3O3 — CID 3983131
N-[1-[2-[(2-butoxynaphthalen-1-yl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-3,4-dichlorobenzamide (PubChem CID 3983131) has the molecular formula C27H29Cl2N3O3 and a molecular weight of 514.45 g/mol. Its IUPAC name is N-[1-[2-[(2-butoxynaphthalen-1-yl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-3,4-dichlorobenzamide.
| Compound Name | N-[1-[2-[(2-butoxynaphthalen-1-yl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 3983131 |
| Molecular Formula | C27H29Cl2N3O3 |
| Molecular Weight | 514.45 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | N-[1-[2-[(2-butoxynaphthalen-1-yl)methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-3,4-dichlorobenzamide |
| SMILES | CCCCOc1ccc2ccccc2c1C=NNC(=O)C(NC(=O)c1ccc(Cl)c(Cl)c1)C(C)C |
| InChI | InChI=1S/C27H29Cl2N3O3/c1-4-5-14-35-24-13-11-18-8-6-7-9-20(18)21(24)16-30-32-27(34)25(17(2)3)31-26(33)19-10-12-22(28)23(29)15-19/h6-13,15-17,25H,4-5,14H2,1-3H3,(H,31,33)(H,32,34) |
| InChIKey | PDIQCPAWFJOAHJ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.45 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|