C24H28Cl2N6O4 — CID 6292757
3,4-dichloro-N-[3-methyl-1-[(2Z)-2-[[4-(4-methylpiperazin-1-yl)-3-nitrophenyl]methylidene]hydrazinyl]-1-oxobutan-2-yl]benzamide (PubChem CID 6292757) has the molecular formula C24H28Cl2N6O4 and a molecular weight of 535.43 g/mol. Its IUPAC name is 3,4-dichloro-N-[3-methyl-1-[(2Z)-2-[[4-(4-methylpiperazin-1-yl)-3-nitrophenyl]methylidene]hydrazinyl]-1-oxobutan-2-yl]benzamide.
| Compound Name | 3,4-dichloro-N-[3-methyl-1-[(2Z)-2-[[4-(4-methylpiperazin-1-yl)-3-nitrophenyl]methylidene]hydrazinyl]-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 6292757 |
| Molecular Formula | C24H28Cl2N6O4 |
| Molecular Weight | 535.43 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | 3,4-dichloro-N-[3-methyl-1-[(2Z)-2-[[4-(4-methylpiperazin-1-yl)-3-nitrophenyl]methylidene]hydrazinyl]-1-oxobutan-2-yl]benzamide |
| SMILES | CC(C)C(NC(=O)c1ccc(Cl)c(Cl)c1)C(=O)N/N=C\c1ccc(N2CCN(C)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H28Cl2N6O4/c1-15(2)22(28-23(33)17-5-6-18(25)19(26)13-17)24(34)29-27-14-16-4-7-20(21(12-16)32(35)36)31-10-8-30(3)9-11-31/h4-7,12-15,22H,8-11H2,1-3H3,(H,28,33)(H,29,34)/b27-14- |
| InChIKey | HUZRVCKUYLANDZ-VYYCAZPPSA-N |
| XLogP | 3.56 |
| TPSA | 120.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|