C22H26Cl2N4O3 — CID 4009429
3,4-dichloro-N-[3-methyl-1-oxo-1-[2-[(5-piperidin-1-ylfuran-2-yl)methylidene]hydrazinyl]butan-2-yl]benzamide (PubChem CID 4009429) has the molecular formula C22H26Cl2N4O3 and a molecular weight of 465.38 g/mol. Its IUPAC name is 3,4-dichloro-N-[3-methyl-1-oxo-1-[2-[(5-piperidin-1-ylfuran-2-yl)methylidene]hydrazinyl]butan-2-yl]benzamide.
| Compound Name | 3,4-dichloro-N-[3-methyl-1-oxo-1-[2-[(5-piperidin-1-ylfuran-2-yl)methylidene]hydrazinyl]butan-2-yl]benzamide |
|---|---|
| PubChem CID | 4009429 |
| Molecular Formula | C22H26Cl2N4O3 |
| Molecular Weight | 465.38 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 3,4-dichloro-N-[3-methyl-1-oxo-1-[2-[(5-piperidin-1-ylfuran-2-yl)methylidene]hydrazinyl]butan-2-yl]benzamide |
| SMILES | CC(C)C(NC(=O)c1ccc(Cl)c(Cl)c1)C(=O)NN=Cc1ccc(N2CCCCC2)o1 |
| InChI | InChI=1S/C22H26Cl2N4O3/c1-14(2)20(26-21(29)15-6-8-17(23)18(24)12-15)22(30)27-25-13-16-7-9-19(31-16)28-10-4-3-5-11-28/h6-9,12-14,20H,3-5,10-11H2,1-2H3,(H,26,29)(H,27,30) |
| InChIKey | OIYMBKSJKZGUHL-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.38 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_furan_A(15)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|