C27H29Cl2N5O4 — CID 6069816
3,4-dichloro-N-[3-methyl-1-[(2Z)-2-[[1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]methylidene]hydrazinyl]-1-oxobutan-2-yl]benzamide (PubChem CID 6069816) has the molecular formula C27H29Cl2N5O4 and a molecular weight of 558.47 g/mol. Its IUPAC name is 3,4-dichloro-N-[3-methyl-1-[(2Z)-2-[[1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]methylidene]hydrazinyl]-1-oxobutan-2-yl]benzamide.
| Compound Name | 3,4-dichloro-N-[3-methyl-1-[(2Z)-2-[[1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]methylidene]hydrazinyl]-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 6069816 |
| Molecular Formula | C27H29Cl2N5O4 |
| Molecular Weight | 558.47 g/mol |
| Exact Mass | 557.16 |
| IUPAC Name | 3,4-dichloro-N-[3-methyl-1-[(2Z)-2-[[1-(2-morpholin-4-yl-2-oxoethyl)indol-3-yl]methylidene]hydrazinyl]-1-oxobutan-2-yl]benzamide |
| SMILES | CC(C)C(NC(=O)c1ccc(Cl)c(Cl)c1)C(=O)N/N=C\c1cn(CC(=O)N2CCOCC2)c2ccccc12 |
| InChI | InChI=1S/C27H29Cl2N5O4/c1-17(2)25(31-26(36)18-7-8-21(28)22(29)13-18)27(37)32-30-14-19-15-34(23-6-4-3-5-20(19)23)16-24(35)33-9-11-38-12-10-33/h3-8,13-15,17,25H,9-12,16H2,1-2H3,(H,31,36)(H,32,37)/b30-14- |
| InChIKey | UANRTDCWYJRXST-CPDSRJINSA-N |
| XLogP | 3.71 |
| TPSA | 105.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|