C27H32Cl2N4O6 — CID 6037597
3,4-dichloro-N-[1-[(2Z)-2-[[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 6037597) has the molecular formula C27H32Cl2N4O6 and a molecular weight of 579.48 g/mol. Its IUPAC name is 3,4-dichloro-N-[1-[(2Z)-2-[[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 3,4-dichloro-N-[1-[(2Z)-2-[[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 6037597 |
| Molecular Formula | C27H32Cl2N4O6 |
| Molecular Weight | 579.48 g/mol |
| Exact Mass | 578.17 |
| IUPAC Name | 3,4-dichloro-N-[1-[(2Z)-2-[[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | CCOc1cc(/C=N\NC(=O)C(NC(=O)c2ccc(Cl)c(Cl)c2)C(C)C)ccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C27H32Cl2N4O6/c1-4-38-23-13-18(5-8-22(23)39-16-24(34)33-9-11-37-12-10-33)15-30-32-27(36)25(17(2)3)31-26(35)19-6-7-20(28)21(29)14-19/h5-8,13-15,17,25H,4,9-12,16H2,1-3H3,(H,31,35)(H,32,36)/b30-15- |
| InChIKey | ZUVWMXGWFUTWBA-MNDYBZJGSA-N |
| XLogP | 3.53 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|