C25H29ClN4O5 — CID 5018350
2-chloro-N-[3-methyl-1-[2-[[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]hydrazinyl]-1-oxobutan-2-yl]benzamide (PubChem CID 5018350) has the molecular formula C25H29ClN4O5 and a molecular weight of 500.98 g/mol. Its IUPAC name is 2-chloro-N-[3-methyl-1-[2-[[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]hydrazinyl]-1-oxobutan-2-yl]benzamide.
| Compound Name | 2-chloro-N-[3-methyl-1-[2-[[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]hydrazinyl]-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 5018350 |
| Molecular Formula | C25H29ClN4O5 |
| Molecular Weight | 500.98 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | 2-chloro-N-[3-methyl-1-[2-[[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]hydrazinyl]-1-oxobutan-2-yl]benzamide |
| SMILES | CC(C)C(NC(=O)c1ccccc1Cl)C(=O)NN=Cc1ccc(OCC(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C25H29ClN4O5/c1-17(2)23(28-24(32)20-5-3-4-6-21(20)26)25(33)29-27-15-18-7-9-19(10-8-18)35-16-22(31)30-11-13-34-14-12-30/h3-10,15,17,23H,11-14,16H2,1-2H3,(H,28,32)(H,29,33) |
| InChIKey | RNURLYIJOKRIQX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.98 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|