C22H24ClN3O6 — CID 51641793
2-(4-chlorophenoxy)-N-[(Z)-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]acetamide (PubChem CID 51641793) has the molecular formula C22H24ClN3O6 and a molecular weight of 461.90 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[(Z)-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[(Z)-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 51641793 |
| Molecular Formula | C22H24ClN3O6 |
| Molecular Weight | 461.90 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[(Z)-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]acetamide |
| SMILES | COc1cc(/C=N\NC(=O)COc2ccc(Cl)cc2)ccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C22H24ClN3O6/c1-29-20-12-16(2-7-19(20)32-15-22(28)26-8-10-30-11-9-26)13-24-25-21(27)14-31-18-5-3-17(23)4-6-18/h2-7,12-13H,8-11,14-15H2,1H3,(H,25,27)/b24-13- |
| InChIKey | MXGRWRWJLPHONU-CFRMEGHHSA-N |
| XLogP | 2.12 |
| TPSA | 98.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.90 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|