C20H28N4O6 — CID 126276741
N-[(2R)-butan-2-yl]-N'-[(Z)-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]oxamide (PubChem CID 126276741) has the molecular formula C20H28N4O6 and a molecular weight of 420.47 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-N'-[(Z)-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]oxamide.
| Compound Name | N-[(2R)-butan-2-yl]-N'-[(Z)-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 126276741 |
| Molecular Formula | C20H28N4O6 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | N-[(2R)-butan-2-yl]-N'-[(Z)-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]oxamide |
| SMILES | CC[C@@H](C)NC(=O)C(=O)N/N=C\c1ccc(OCC(=O)N2CCOCC2)c(OC)c1 |
| InChI | InChI=1S/C20H28N4O6/c1-4-14(2)22-19(26)20(27)23-21-12-15-5-6-16(17(11-15)28-3)30-13-18(25)24-7-9-29-10-8-24/h5-6,11-12,14H,4,7-10,13H2,1-3H3,(H,22,26)(H,23,27)/b21-12-/t14-/m1/s1 |
| InChIKey | QYRRZSKZFWYZEL-LQFJMUIISA-N |
| XLogP | 0.30 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|