C19H28N4O5S — CID 9176141
1-[(Z)-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-3-[(2R)-1-methoxypropan-2-yl]thiourea (PubChem CID 9176141) has the molecular formula C19H28N4O5S and a molecular weight of 424.52 g/mol. Its IUPAC name is 1-[(Z)-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-3-[(2R)-1-methoxypropan-2-yl]thiourea.
| Compound Name | 1-[(Z)-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-3-[(2R)-1-methoxypropan-2-yl]thiourea |
|---|---|
| PubChem CID | 9176141 |
| Molecular Formula | C19H28N4O5S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 1-[(Z)-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-3-[(2R)-1-methoxypropan-2-yl]thiourea |
| SMILES | COC[C@@H](C)NC(=S)N/N=C\c1ccc(OCC(=O)N2CCOCC2)c(OC)c1 |
| InChI | InChI=1S/C19H28N4O5S/c1-14(12-25-2)21-19(29)22-20-11-15-4-5-16(17(10-15)26-3)28-13-18(24)23-6-8-27-9-7-23/h4-5,10-11,14H,6-9,12-13H2,1-3H3,(H2,21,22,29)/b20-11-/t14-/m1/s1 |
| InChIKey | FKHIQZWRWZBMPQ-LPKQHDGYSA-N |
| XLogP | 0.77 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|