C17H27N3O3S — CID 9176136
1-[(Z)-[3-methoxy-4-(2-methylpropoxy)phenyl]methylideneamino]-3-[(2S)-1-methoxypropan-2-yl]thiourea (PubChem CID 9176136) has the molecular formula C17H27N3O3S and a molecular weight of 353.49 g/mol. Its IUPAC name is 1-[(Z)-[3-methoxy-4-(2-methylpropoxy)phenyl]methylideneamino]-3-[(2S)-1-methoxypropan-2-yl]thiourea.
| Compound Name | 1-[(Z)-[3-methoxy-4-(2-methylpropoxy)phenyl]methylideneamino]-3-[(2S)-1-methoxypropan-2-yl]thiourea |
|---|---|
| PubChem CID | 9176136 |
| Molecular Formula | C17H27N3O3S |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 1-[(Z)-[3-methoxy-4-(2-methylpropoxy)phenyl]methylideneamino]-3-[(2S)-1-methoxypropan-2-yl]thiourea |
| SMILES | COC[C@H](C)NC(=S)N/N=C\c1ccc(OCC(C)C)c(OC)c1 |
| InChI | InChI=1S/C17H27N3O3S/c1-12(2)10-23-15-7-6-14(8-16(15)22-5)9-18-20-17(24)19-13(3)11-21-4/h6-9,12-13H,10-11H2,1-5H3,(H2,19,20,24)/b18-9-/t13-/m0/s1 |
| InChIKey | UGNBSBLUEQAECO-OCTXWABXSA-N |
| XLogP | 2.56 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|