C13H19N3OS2 — CID 9176021
1-[(2R)-1-methoxypropan-2-yl]-3-[(Z)-(4-methylsulfanylphenyl)methylideneamino]thiourea (PubChem CID 9176021) has the molecular formula C13H19N3OS2 and a molecular weight of 297.45 g/mol. Its IUPAC name is 1-[(2R)-1-methoxypropan-2-yl]-3-[(Z)-(4-methylsulfanylphenyl)methylideneamino]thiourea.
| Compound Name | 1-[(2R)-1-methoxypropan-2-yl]-3-[(Z)-(4-methylsulfanylphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 9176021 |
| Molecular Formula | C13H19N3OS2 |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 1-[(2R)-1-methoxypropan-2-yl]-3-[(Z)-(4-methylsulfanylphenyl)methylideneamino]thiourea |
| SMILES | COC[C@@H](C)NC(=S)N/N=C\c1ccc(SC)cc1 |
| InChI | InChI=1S/C13H19N3OS2/c1-10(9-17-2)15-13(18)16-14-8-11-4-6-12(19-3)7-5-11/h4-8,10H,9H2,1-3H3,(H2,15,16,18)/b14-8-/t10-/m1/s1 |
| InChIKey | UZTAGYALXBRCHB-DOQDJBIESA-N |
| XLogP | 2.24 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|