C23H26N4O7 — CID 46502216
N-[(E)-[3-methoxy-4-(2-oxo-2-piperidin-1-ylethoxy)phenyl]methylideneamino]-2-(4-nitrophenoxy)acetamide (PubChem CID 46502216) has the molecular formula C23H26N4O7 and a molecular weight of 470.48 g/mol. Its IUPAC name is N-[(E)-[3-methoxy-4-(2-oxo-2-piperidin-1-ylethoxy)phenyl]methylideneamino]-2-(4-nitrophenoxy)acetamide.
| Compound Name | N-[(E)-[3-methoxy-4-(2-oxo-2-piperidin-1-ylethoxy)phenyl]methylideneamino]-2-(4-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 46502216 |
| Molecular Formula | C23H26N4O7 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | N-[(E)-[3-methoxy-4-(2-oxo-2-piperidin-1-ylethoxy)phenyl]methylideneamino]-2-(4-nitrophenoxy)acetamide |
| SMILES | COc1cc(/C=N/NC(=O)COc2ccc([N+](=O)[O-])cc2)ccc1OCC(=O)N1CCCCC1 |
| InChI | InChI=1S/C23H26N4O7/c1-32-21-13-17(5-10-20(21)34-16-23(29)26-11-3-2-4-12-26)14-24-25-22(28)15-33-19-8-6-18(7-9-19)27(30)31/h5-10,13-14H,2-4,11-12,15-16H2,1H3,(H,25,28)/b24-14+ |
| InChIKey | YHFSQWRVEITBMH-ZVHZXABRSA-N |
| XLogP | 2.52 |
| TPSA | 132.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|