C21H20Cl3N3O5 — CID 126027677
N-[(Z)-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-2-(2,3,5-trichlorophenoxy)acetamide (PubChem CID 126027677) has the molecular formula C21H20Cl3N3O5 and a molecular weight of 500.77 g/mol. Its IUPAC name is N-[(Z)-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-2-(2,3,5-trichlorophenoxy)acetamide.
| Compound Name | N-[(Z)-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-2-(2,3,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 126027677 |
| Molecular Formula | C21H20Cl3N3O5 |
| Molecular Weight | 500.77 g/mol |
| Exact Mass | 499.05 |
| IUPAC Name | N-[(Z)-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-2-(2,3,5-trichlorophenoxy)acetamide |
| SMILES | O=C(COc1cc(Cl)cc(Cl)c1Cl)N/N=C\c1ccc(OCC(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C21H20Cl3N3O5/c22-15-9-17(23)21(24)18(10-15)32-12-19(28)26-25-11-14-1-3-16(4-2-14)31-13-20(29)27-5-7-30-8-6-27/h1-4,9-11H,5-8,12-13H2,(H,26,28)/b25-11- |
| InChIKey | XVKOCGJNIVXRGM-GATIEOLUSA-N |
| XLogP | 3.41 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.77 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|