C22H24BrN3O4S — CID 73406075
2-[(3-bromophenyl)methylsulfanyl]-N-[[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]acetamide (PubChem CID 73406075) has the molecular formula C22H24BrN3O4S and a molecular weight of 506.42 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methylsulfanyl]-N-[[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]acetamide.
| Compound Name | 2-[(3-bromophenyl)methylsulfanyl]-N-[[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 73406075 |
| Molecular Formula | C22H24BrN3O4S |
| Molecular Weight | 506.42 g/mol |
| Exact Mass | 505.07 |
| IUPAC Name | 2-[(3-bromophenyl)methylsulfanyl]-N-[[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]acetamide |
| SMILES | O=C(CSCc1cccc(Br)c1)NN=Cc1ccc(OCC(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H24BrN3O4S/c23-19-3-1-2-18(12-19)15-31-16-21(27)25-24-13-17-4-6-20(7-5-17)30-14-22(28)26-8-10-29-11-9-26/h1-7,12-13H,8-11,14-16H2,(H,25,27) |
| InChIKey | YFCHQWRHAYYXLK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|