C22H22F3N3O4 — CID 126015984
N-[(E)-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 126015984) has the molecular formula C22H22F3N3O4 and a molecular weight of 449.43 g/mol. Its IUPAC name is N-[(E)-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[(E)-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 126015984 |
| Molecular Formula | C22H22F3N3O4 |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | N-[(E)-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(Cc1cccc(C(F)(F)F)c1)N/N=C/c1ccc(OCC(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H22F3N3O4/c23-22(24,25)18-3-1-2-17(12-18)13-20(29)27-26-14-16-4-6-19(7-5-16)32-15-21(30)28-8-10-31-11-9-28/h1-7,12,14H,8-11,13,15H2,(H,27,29)/b26-14+ |
| InChIKey | FETXWWCTQJWOFQ-VULFUBBASA-N |
| XLogP | 2.64 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|