C17H12F3N2O3- — CID 7256534
4-[(Z)-[[2-[3-(trifluoromethyl)phenyl]acetyl]hydrazinylidene]methyl]benzoate (PubChem CID 7256534) has the molecular formula C17H12F3N2O3- and a molecular weight of 349.29 g/mol. Its IUPAC name is 4-[(Z)-[[2-[3-(trifluoromethyl)phenyl]acetyl]hydrazinylidene]methyl]benzoate.
| Compound Name | 4-[(Z)-[[2-[3-(trifluoromethyl)phenyl]acetyl]hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 7256534 |
| Molecular Formula | C17H12F3N2O3- |
| Molecular Weight | 349.29 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 4-[(Z)-[[2-[3-(trifluoromethyl)phenyl]acetyl]hydrazinylidene]methyl]benzoate |
| SMILES | O=C(Cc1cccc(C(F)(F)F)c1)N/N=C\c1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C17H13F3N2O3/c18-17(19,20)14-3-1-2-12(8-14)9-15(23)22-21-10-11-4-6-13(7-5-11)16(24)25/h1-8,10H,9H2,(H,22,23)(H,24,25)/p-1/b21-10- |
| InChIKey | YZEYCNXSBJDXRG-FBHDLOMBSA-M |
| XLogP | 1.76 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.29 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|