C15H10F3IN2O — CID 21211160
N-[(E)-(4-iodophenyl)methylideneamino]-3-(trifluoromethyl)benzamide (PubChem CID 21211160) has the molecular formula C15H10F3IN2O and a molecular weight of 418.16 g/mol. Its IUPAC name is N-[(E)-(4-iodophenyl)methylideneamino]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[(E)-(4-iodophenyl)methylideneamino]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 21211160 |
| Molecular Formula | C15H10F3IN2O |
| Molecular Weight | 418.16 g/mol |
| Exact Mass | 417.98 |
| IUPAC Name | N-[(E)-(4-iodophenyl)methylideneamino]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(N/N=C/c1ccc(I)cc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H10F3IN2O/c16-15(17,18)12-3-1-2-11(8-12)14(22)21-20-9-10-4-6-13(19)7-5-10/h1-9H,(H,21,22)/b20-9+ |
| InChIKey | ZWKRAZUTUQIQTI-AWQFTUOYSA-N |
| XLogP | 4.07 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.16 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|