C15H11F3N2O3 — CID 135546449
N-[(E)-(2,5-dihydroxyphenyl)methylideneamino]-3-(trifluoromethyl)benzamide (PubChem CID 135546449) has the molecular formula C15H11F3N2O3 and a molecular weight of 324.26 g/mol. Its IUPAC name is N-[(E)-(2,5-dihydroxyphenyl)methylideneamino]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[(E)-(2,5-dihydroxyphenyl)methylideneamino]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 135546449 |
| Molecular Formula | C15H11F3N2O3 |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | N-[(E)-(2,5-dihydroxyphenyl)methylideneamino]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(N/N=C/c1cc(O)ccc1O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H11F3N2O3/c16-15(17,18)11-3-1-2-9(6-11)14(23)20-19-8-10-7-12(21)4-5-13(10)22/h1-8,21-22H,(H,20,23)/b19-8+ |
| InChIKey | FYQKJVUUIJNQIO-UFWORHAWSA-N |
| XLogP | 2.88 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|