C15H10F3N2O2- — CID 7529688
3-[(2Z)-2-[[4-(trifluoromethyl)phenyl]methylidene]hydrazinyl]benzoate (PubChem CID 7529688) has the molecular formula C15H10F3N2O2- and a molecular weight of 307.25 g/mol. Its IUPAC name is 3-[(2Z)-2-[[4-(trifluoromethyl)phenyl]methylidene]hydrazinyl]benzoate.
| Compound Name | 3-[(2Z)-2-[[4-(trifluoromethyl)phenyl]methylidene]hydrazinyl]benzoate |
|---|---|
| PubChem CID | 7529688 |
| Molecular Formula | C15H10F3N2O2- |
| Molecular Weight | 307.25 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 3-[(2Z)-2-[[4-(trifluoromethyl)phenyl]methylidene]hydrazinyl]benzoate |
| SMILES | O=C([O-])c1cccc(N/N=C\c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C15H11F3N2O2/c16-15(17,18)12-6-4-10(5-7-12)9-19-20-13-3-1-2-11(8-13)14(21)22/h1-9,20H,(H,21,22)/p-1/b19-9- |
| InChIKey | IQIRDIYMHAENGM-OCKHKDLRSA-M |
| XLogP | 2.51 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.25 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|