C17H18N3O3- — CID 7955313
3-[(2Z)-2-[[4-[2-hydroxyethyl(methyl)amino]phenyl]methylidene]hydrazinyl]benzoate (PubChem CID 7955313) has the molecular formula C17H18N3O3- and a molecular weight of 312.35 g/mol. Its IUPAC name is 3-[(2Z)-2-[[4-[2-hydroxyethyl(methyl)amino]phenyl]methylidene]hydrazinyl]benzoate.
| Compound Name | 3-[(2Z)-2-[[4-[2-hydroxyethyl(methyl)amino]phenyl]methylidene]hydrazinyl]benzoate |
|---|---|
| PubChem CID | 7955313 |
| Molecular Formula | C17H18N3O3- |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 3-[(2Z)-2-[[4-[2-hydroxyethyl(methyl)amino]phenyl]methylidene]hydrazinyl]benzoate |
| SMILES | CN(CCO)c1ccc(/C=N\Nc2cccc(C(=O)[O-])c2)cc1 |
| InChI | InChI=1S/C17H19N3O3/c1-20(9-10-21)16-7-5-13(6-8-16)12-18-19-15-4-2-3-14(11-15)17(22)23/h2-8,11-12,19,21H,9-10H2,1H3,(H,22,23)/p-1/b18-12- |
| InChIKey | RADZOMHPESVYAM-PDGQHHTCSA-M |
| XLogP | 0.92 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|