C20H25N3O3 — CID 9215811
N-[(Z)-[4-[2-hydroxyethyl(methyl)amino]phenyl]methylideneamino]-4-propan-2-yloxybenzamide (PubChem CID 9215811) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is N-[(Z)-[4-[2-hydroxyethyl(methyl)amino]phenyl]methylideneamino]-4-propan-2-yloxybenzamide.
| Compound Name | N-[(Z)-[4-[2-hydroxyethyl(methyl)amino]phenyl]methylideneamino]-4-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 9215811 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | N-[(Z)-[4-[2-hydroxyethyl(methyl)amino]phenyl]methylideneamino]-4-propan-2-yloxybenzamide |
| SMILES | CC(C)Oc1ccc(C(=O)N/N=C\c2ccc(N(C)CCO)cc2)cc1 |
| InChI | InChI=1S/C20H25N3O3/c1-15(2)26-19-10-6-17(7-11-19)20(25)22-21-14-16-4-8-18(9-5-16)23(3)12-13-24/h4-11,14-15,24H,12-13H2,1-3H3,(H,22,25)/b21-14- |
| InChIKey | KAZLHUPDFNNXGH-STZFKDTASA-N |
| XLogP | 2.67 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|