C32H32N6O3 — CID 75965267
4-(dimethylamino)-N-[[4-[4-[[[4-(dimethylamino)benzoyl]hydrazinylidene]methyl]phenoxy]phenyl]methylideneamino]benzamide (PubChem CID 75965267) has the molecular formula C32H32N6O3 and a molecular weight of 548.65 g/mol. Its IUPAC name is 4-(dimethylamino)-N-[[4-[4-[[[4-(dimethylamino)benzoyl]hydrazinylidene]methyl]phenoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 4-(dimethylamino)-N-[[4-[4-[[[4-(dimethylamino)benzoyl]hydrazinylidene]methyl]phenoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 75965267 |
| Molecular Formula | C32H32N6O3 |
| Molecular Weight | 548.65 g/mol |
| Exact Mass | 548.25 |
| IUPAC Name | 4-(dimethylamino)-N-[[4-[4-[[[4-(dimethylamino)benzoyl]hydrazinylidene]methyl]phenoxy]phenyl]methylideneamino]benzamide |
| SMILES | CN(C)c1ccc(C(=O)NN=Cc2ccc(Oc3ccc(C=NNC(=O)c4ccc(N(C)C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H32N6O3/c1-37(2)27-13-9-25(10-14-27)31(39)35-33-21-23-5-17-29(18-6-23)41-30-19-7-24(8-20-30)22-34-36-32(40)26-11-15-28(16-12-26)38(3)4/h5-22H,1-4H3,(H,35,39)(H,36,40) |
| InChIKey | DBJLCFHULYWGSZ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 98.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.65 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|