C28H30N6O2 — CID 89119525
N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-4-[(E)-3-[(2E)-2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]-3-oxoprop-1-enyl]benzamide (PubChem CID 89119525) has the molecular formula C28H30N6O2 and a molecular weight of 482.59 g/mol. Its IUPAC name is N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-4-[(E)-3-[(2E)-2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]-3-oxoprop-1-enyl]benzamide.
| Compound Name | N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-4-[(E)-3-[(2E)-2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]-3-oxoprop-1-enyl]benzamide |
|---|---|
| PubChem CID | 89119525 |
| Molecular Formula | C28H30N6O2 |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-4-[(E)-3-[(2E)-2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]-3-oxoprop-1-enyl]benzamide |
| SMILES | CN(C)c1ccc(/C=N/NC(=O)/C=C/c2ccc(C(=O)N/N=C/c3ccc(N(C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C28H30N6O2/c1-33(2)25-14-7-22(8-15-25)19-29-31-27(35)18-11-21-5-12-24(13-6-21)28(36)32-30-20-23-9-16-26(17-10-23)34(3)4/h5-20H,1-4H3,(H,31,35)(H,32,36)/b18-11+,29-19+,30-20+ |
| InChIKey | ZIHCJEFFYQBDRF-DIDHJXBKSA-N |
| XLogP | 3.75 |
| TPSA | 89.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|