C16H15N2O3- — CID 7992359
3-[(2Z)-2-[(2-ethoxyphenyl)methylidene]hydrazinyl]benzoate (PubChem CID 7992359) has the molecular formula C16H15N2O3- and a molecular weight of 283.31 g/mol. Its IUPAC name is 3-[(2Z)-2-[(2-ethoxyphenyl)methylidene]hydrazinyl]benzoate.
| Compound Name | 3-[(2Z)-2-[(2-ethoxyphenyl)methylidene]hydrazinyl]benzoate |
|---|---|
| PubChem CID | 7992359 |
| Molecular Formula | C16H15N2O3- |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 3-[(2Z)-2-[(2-ethoxyphenyl)methylidene]hydrazinyl]benzoate |
| SMILES | CCOc1ccccc1/C=N\Nc1cccc(C(=O)[O-])c1 |
| InChI | InChI=1S/C16H16N2O3/c1-2-21-15-9-4-3-6-13(15)11-17-18-14-8-5-7-12(10-14)16(19)20/h3-11,18H,2H2,1H3,(H,19,20)/p-1/b17-11- |
| InChIKey | WWXXKLWJZRUMEW-BOPFTXTBSA-M |
| XLogP | 1.89 |
| TPSA | 73.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|