C16H16N3O2- — CID 7065216
3-[(2Z)-2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]benzoate (PubChem CID 7065216) has the molecular formula C16H16N3O2- and a molecular weight of 282.32 g/mol. Its IUPAC name is 3-[(2Z)-2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]benzoate.
| Compound Name | 3-[(2Z)-2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]benzoate |
|---|---|
| PubChem CID | 7065216 |
| Molecular Formula | C16H16N3O2- |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 3-[(2Z)-2-[[4-(dimethylamino)phenyl]methylidene]hydrazinyl]benzoate |
| SMILES | CN(C)c1ccc(/C=N\Nc2cccc(C(=O)[O-])c2)cc1 |
| InChI | InChI=1S/C16H17N3O2/c1-19(2)15-8-6-12(7-9-15)11-17-18-14-5-3-4-13(10-14)16(20)21/h3-11,18H,1-2H3,(H,20,21)/p-1/b17-11- |
| InChIKey | VJJXVBDYMKJSQJ-BOPFTXTBSA-M |
| XLogP | 1.56 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|