C16H19N3O3 — CID 166598868
3-[4-(dimethylamino)anilino]benzamide;formic acid (PubChem CID 166598868) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is 3-[4-(dimethylamino)anilino]benzamide;formic acid.
| Compound Name | 3-[4-(dimethylamino)anilino]benzamide;formic acid |
|---|---|
| PubChem CID | 166598868 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 3-[4-(dimethylamino)anilino]benzamide;formic acid |
| SMILES | CN(C)c1ccc(Nc2cccc(C(N)=O)c2)cc1.O=CO |
| InChI | InChI=1S/C15H17N3O.CH2O2/c1-18(2)14-8-6-12(7-9-14)17-13-5-3-4-11(10-13)15(16)19;2-1-3/h3-10,17H,1-2H3,(H2,16,19);1H,(H,2,3) |
| InChIKey | KWNBSLMWTNHUPI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|