C20H15N2O5S- — CID 7786687
3-[(2Z)-2-[[3-methoxy-4-(thiophene-2-carbonyloxy)phenyl]methylidene]hydrazinyl]benzoate (PubChem CID 7786687) has the molecular formula C20H15N2O5S- and a molecular weight of 395.42 g/mol. Its IUPAC name is 3-[(2Z)-2-[[3-methoxy-4-(thiophene-2-carbonyloxy)phenyl]methylidene]hydrazinyl]benzoate.
| Compound Name | 3-[(2Z)-2-[[3-methoxy-4-(thiophene-2-carbonyloxy)phenyl]methylidene]hydrazinyl]benzoate |
|---|---|
| PubChem CID | 7786687 |
| Molecular Formula | C20H15N2O5S- |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | 3-[(2Z)-2-[[3-methoxy-4-(thiophene-2-carbonyloxy)phenyl]methylidene]hydrazinyl]benzoate |
| SMILES | COc1cc(/C=N\Nc2cccc(C(=O)[O-])c2)ccc1OC(=O)c1cccs1 |
| InChI | InChI=1S/C20H16N2O5S/c1-26-17-10-13(7-8-16(17)27-20(25)18-6-3-9-28-18)12-21-22-15-5-2-4-14(11-15)19(23)24/h2-12,22H,1H3,(H,23,24)/p-1/b21-12- |
| InChIKey | PPXHCOPWYXMNNN-MTJSOVHGSA-M |
| XLogP | 2.79 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|