C19H16N2O5S2 — CID 2692698
[4-[(benzenesulfonylhydrazinylidene)methyl]-2-methoxyphenyl] thiophene-2-carboxylate (PubChem CID 2692698) has the molecular formula C19H16N2O5S2 and a molecular weight of 416.48 g/mol. Its IUPAC name is [4-[(benzenesulfonylhydrazinylidene)methyl]-2-methoxyphenyl] thiophene-2-carboxylate.
| Compound Name | [4-[(benzenesulfonylhydrazinylidene)methyl]-2-methoxyphenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 2692698 |
| Molecular Formula | C19H16N2O5S2 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | [4-[(benzenesulfonylhydrazinylidene)methyl]-2-methoxyphenyl] thiophene-2-carboxylate |
| SMILES | COc1cc(C=NNS(=O)(=O)c2ccccc2)ccc1OC(=O)c1cccs1 |
| InChI | InChI=1S/C19H16N2O5S2/c1-25-17-12-14(9-10-16(17)26-19(22)18-8-5-11-27-18)13-20-21-28(23,24)15-6-3-2-4-7-15/h2-13,21H,1H3 |
| InChIKey | VMBIJQHFIKTNLW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|