C29H24N4O4S — CID 3988989
[4-[[(5,5-diphenyl-1,4-dihydropyrazole-3-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] thiophene-2-carboxylate (PubChem CID 3988989) has the molecular formula C29H24N4O4S and a molecular weight of 524.60 g/mol. Its IUPAC name is [4-[[(5,5-diphenyl-1,4-dihydropyrazole-3-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] thiophene-2-carboxylate.
| Compound Name | [4-[[(5,5-diphenyl-1,4-dihydropyrazole-3-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 3988989 |
| Molecular Formula | C29H24N4O4S |
| Molecular Weight | 524.60 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | [4-[[(5,5-diphenyl-1,4-dihydropyrazole-3-carbonyl)hydrazinylidene]methyl]-2-methoxyphenyl] thiophene-2-carboxylate |
| SMILES | COc1cc(C=NNC(=O)C2=NNC(c3ccccc3)(c3ccccc3)C2)ccc1OC(=O)c1cccs1 |
| InChI | InChI=1S/C29H24N4O4S/c1-36-25-17-20(14-15-24(25)37-28(35)26-13-8-16-38-26)19-30-32-27(34)23-18-29(33-31-23,21-9-4-2-5-10-21)22-11-6-3-7-12-22/h2-17,19,33H,18H2,1H3,(H,32,34) |
| InChIKey | SKJNAMBRMXWSJT-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.60 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|