C25H23BrN4O3 — CID 171979458
N-[(E)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-5,5-diphenyl-1,4-dihydropyrazole-3-carboxamide (PubChem CID 171979458) has the molecular formula C25H23BrN4O3 and a molecular weight of 507.39 g/mol. Its IUPAC name is N-[(E)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-5,5-diphenyl-1,4-dihydropyrazole-3-carboxamide.
| Compound Name | N-[(E)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-5,5-diphenyl-1,4-dihydropyrazole-3-carboxamide |
|---|---|
| PubChem CID | 171979458 |
| Molecular Formula | C25H23BrN4O3 |
| Molecular Weight | 507.39 g/mol |
| Exact Mass | 506.10 |
| IUPAC Name | N-[(E)-(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-5,5-diphenyl-1,4-dihydropyrazole-3-carboxamide |
| SMILES | CCOc1cc(/C=N/NC(=O)C2=NNC(c3ccccc3)(c3ccccc3)C2)cc(Br)c1O |
| InChI | InChI=1S/C25H23BrN4O3/c1-2-33-22-14-17(13-20(26)23(22)31)16-27-29-24(32)21-15-25(30-28-21,18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-14,16,30-31H,2,15H2,1H3,(H,29,32)/b27-16+ |
| InChIKey | IIENOEWIMOKNHI-JVWAILMASA-N |
| XLogP | 4.30 |
| TPSA | 95.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.39 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|