C15H15BrN2O4 — CID 3324384
N-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-5-methylfuran-2-carboxamide (PubChem CID 3324384) has the molecular formula C15H15BrN2O4 and a molecular weight of 367.20 g/mol. Its IUPAC name is N-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-5-methylfuran-2-carboxamide.
| Compound Name | N-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-5-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 3324384 |
| Molecular Formula | C15H15BrN2O4 |
| Molecular Weight | 367.20 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | N-[(3-bromo-5-ethoxy-4-hydroxyphenyl)methylideneamino]-5-methylfuran-2-carboxamide |
| SMILES | CCOc1cc(C=NNC(=O)c2ccc(C)o2)cc(Br)c1O |
| InChI | InChI=1S/C15H15BrN2O4/c1-3-21-13-7-10(6-11(16)14(13)19)8-17-18-15(20)12-5-4-9(2)22-12/h4-8,19H,3H2,1-2H3,(H,18,20) |
| InChIKey | ADDKHGPREDHQOF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.20 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|