C20H15Br3N2O3 — CID 21370338
N-[(E)-[3,5-dibromo-4-[(4-bromophenyl)methoxy]phenyl]methylideneamino]-5-methylfuran-2-carboxamide (PubChem CID 21370338) has the molecular formula C20H15Br3N2O3 and a molecular weight of 571.06 g/mol. Its IUPAC name is N-[(E)-[3,5-dibromo-4-[(4-bromophenyl)methoxy]phenyl]methylideneamino]-5-methylfuran-2-carboxamide.
| Compound Name | N-[(E)-[3,5-dibromo-4-[(4-bromophenyl)methoxy]phenyl]methylideneamino]-5-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 21370338 |
| Molecular Formula | C20H15Br3N2O3 |
| Molecular Weight | 571.06 g/mol |
| Exact Mass | 567.86 |
| IUPAC Name | N-[(E)-[3,5-dibromo-4-[(4-bromophenyl)methoxy]phenyl]methylideneamino]-5-methylfuran-2-carboxamide |
| SMILES | Cc1ccc(C(=O)N/N=C/c2cc(Br)c(OCc3ccc(Br)cc3)c(Br)c2)o1 |
| InChI | InChI=1S/C20H15Br3N2O3/c1-12-2-7-18(28-12)20(26)25-24-10-14-8-16(22)19(17(23)9-14)27-11-13-3-5-15(21)6-4-13/h2-10H,11H2,1H3,(H,25,26)/b24-10+ |
| InChIKey | DIOFALUJONPXBB-YSURURNPSA-N |
| XLogP | 6.22 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.06 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|