C20H23N3O3S2 — CID 2387396
[4-[(cyclohexylcarbamothioylhydrazinylidene)methyl]-2-methoxyphenyl] thiophene-2-carboxylate (PubChem CID 2387396) has the molecular formula C20H23N3O3S2 and a molecular weight of 417.56 g/mol. Its IUPAC name is [4-[(cyclohexylcarbamothioylhydrazinylidene)methyl]-2-methoxyphenyl] thiophene-2-carboxylate.
| Compound Name | [4-[(cyclohexylcarbamothioylhydrazinylidene)methyl]-2-methoxyphenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 2387396 |
| Molecular Formula | C20H23N3O3S2 |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | [4-[(cyclohexylcarbamothioylhydrazinylidene)methyl]-2-methoxyphenyl] thiophene-2-carboxylate |
| SMILES | COc1cc(C=NNC(=S)NC2CCCCC2)ccc1OC(=O)c1cccs1 |
| InChI | InChI=1S/C20H23N3O3S2/c1-25-17-12-14(9-10-16(17)26-19(24)18-8-5-11-28-18)13-21-23-20(27)22-15-6-3-2-4-7-15/h5,8-13,15H,2-4,6-7H2,1H3,(H2,22,23,27) |
| InChIKey | MEOOFFCBIQSGLA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|