C16H23N3O2S — CID 717820
1-cyclohexyl-3-[(3,4-dimethoxyphenyl)methylideneamino]thiourea (PubChem CID 717820) has the molecular formula C16H23N3O2S and a molecular weight of 321.45 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(3,4-dimethoxyphenyl)methylideneamino]thiourea.
| Compound Name | 1-cyclohexyl-3-[(3,4-dimethoxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 717820 |
| Molecular Formula | C16H23N3O2S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 1-cyclohexyl-3-[(3,4-dimethoxyphenyl)methylideneamino]thiourea |
| SMILES | COc1ccc(C=NNC(=S)NC2CCCCC2)cc1OC |
| InChI | InChI=1S/C16H23N3O2S/c1-20-14-9-8-12(10-15(14)21-2)11-17-19-16(22)18-13-6-4-3-5-7-13/h8-11,13H,3-7H2,1-2H3,(H2,18,19,22) |
| InChIKey | ZIEGPSXUMGHGCC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|