C18H27N3O2S — CID 7933914
1-cyclohexyl-3-[(Z)-(3-methoxy-4-propoxyphenyl)methylideneamino]thiourea (PubChem CID 7933914) has the molecular formula C18H27N3O2S and a molecular weight of 349.50 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(Z)-(3-methoxy-4-propoxyphenyl)methylideneamino]thiourea.
| Compound Name | 1-cyclohexyl-3-[(Z)-(3-methoxy-4-propoxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 7933914 |
| Molecular Formula | C18H27N3O2S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 1-cyclohexyl-3-[(Z)-(3-methoxy-4-propoxyphenyl)methylideneamino]thiourea |
| SMILES | CCCOc1ccc(/C=N\NC(=S)NC2CCCCC2)cc1OC |
| InChI | InChI=1S/C18H27N3O2S/c1-3-11-23-16-10-9-14(12-17(16)22-2)13-19-21-18(24)20-15-7-5-4-6-8-15/h9-10,12-13,15H,3-8,11H2,1-2H3,(H2,20,21,24)/b19-13- |
| InChIKey | ZVPLIFDEDRSKDL-UYRXBGFRSA-N |
| XLogP | 3.61 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|