C19H29N3O2S — CID 112538633
1-cyclohexyl-3-[(Z)-(3-ethoxy-4-propoxyphenyl)methylideneamino]thiourea (PubChem CID 112538633) has the molecular formula C19H29N3O2S and a molecular weight of 363.53 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(Z)-(3-ethoxy-4-propoxyphenyl)methylideneamino]thiourea.
| Compound Name | 1-cyclohexyl-3-[(Z)-(3-ethoxy-4-propoxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 112538633 |
| Molecular Formula | C19H29N3O2S |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | 1-cyclohexyl-3-[(Z)-(3-ethoxy-4-propoxyphenyl)methylideneamino]thiourea |
| SMILES | CCCOc1ccc(/C=N\NC(=S)NC2CCCCC2)cc1OCC |
| InChI | InChI=1S/C19H29N3O2S/c1-3-12-24-17-11-10-15(13-18(17)23-4-2)14-20-22-19(25)21-16-8-6-5-7-9-16/h10-11,13-14,16H,3-9,12H2,1-2H3,(H2,21,22,25)/b20-14- |
| InChIKey | YKFVFFALKRYEQO-ZHZULCJRSA-N |
| XLogP | 4.00 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|